C15H11F3N2 — CID 63052744
4-[[(3,4,5-trifluorophenyl)methylamino]methyl]benzonitrile (PubChem CID 63052744) has the molecular formula C15H11F3N2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-[[(3,4,5-trifluorophenyl)methylamino]methyl]benzonitrile.
| Compound Name | 4-[[(3,4,5-trifluorophenyl)methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 63052744 |
| Molecular Formula | C15H11F3N2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-[[(3,4,5-trifluorophenyl)methylamino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNCc2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H11F3N2/c16-13-5-12(6-14(17)15(13)18)9-20-8-11-3-1-10(7-19)2-4-11/h1-6,20H,8-9H2 |
| InChIKey | NIDFSKIZEIKVCY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|