About ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate
ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate (PubChem CID 63053944) has the molecular formula C13H26N2O3
and a molecular weight of 258.36 g/mol. Its IUPAC name is ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate.
Molecular Properties
| Compound Name | ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate |
| PubChem CID | 63053944 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate |
| SMILES | CCOC(=O)C(CCN1CCOCC1(C)C)NC |
| InChI | InChI=1S/C13H26N2O3/c1-5-18-12(16)11(14-4)6-7-15-8-9-17-10-13(15,2)3/h11,14H,5-10H2,1-4H3 |
| InChIKey | CDRVIROSANDCTD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate?
The IUPAC name of ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate (CID 63053944) is ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate.
What is the SMILES notation for ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate?
The canonical SMILES for ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate is CCOC(=O)C(CCN1CCOCC1(C)C)NC.
What is the InChIKey of ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate?
The InChIKey is CDRVIROSANDCTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3/c1-5-18-12(16)11(14-4)6-7-15-8-9-17-10-13(15,2)3/h11,14H,5-10H2,1-4H3.
What are the key properties of ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate?
ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate has a molecular weight of 258.36 g/mol, XLogP of 0.64, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3,3-dimethylmorpholin-4-yl)-2-(methylamino)butanoate is sourced from PubChem (CID 63053944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).