About [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate
[(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate (PubChem CID 6305399) has the molecular formula C15H15N3O4
and a molecular weight of 301.30 g/mol. Its IUPAC name is [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate.
Molecular Properties
| Compound Name | [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate |
| PubChem CID | 6305399 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate |
| SMILES | COc1cccc(OC)c1C(=O)O/N=C(\N)c1ccncc1 |
| InChI | InChI=1S/C15H15N3O4/c1-20-11-4-3-5-12(21-2)13(11)15(19)22-18-14(16)10-6-8-17-9-7-10/h3-9H,1-2H3,(H2,16,18) |
| InChIKey | OZEFPPKPFJGKSL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate?
The IUPAC name of [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate (CID 6305399) is [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate.
What is the SMILES notation for [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate?
The canonical SMILES for [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate is COc1cccc(OC)c1C(=O)O/N=C(\N)c1ccncc1.
What is the InChIKey of [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate?
The InChIKey is OZEFPPKPFJGKSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O4/c1-20-11-4-3-5-12(21-2)13(11)15(19)22-18-14(16)10-6-8-17-9-7-10/h3-9H,1-2H3,(H2,16,18).
What are the key properties of [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate?
[(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate has a molecular weight of 301.30 g/mol, XLogP of 1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino(pyridin-4-yl)methylidene]amino] 2,6-dimethoxybenzoate is sourced from PubChem (CID 6305399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).