C16H20BrNOS — CID 63056052
N-[[3-[(4-bromothiophen-2-yl)methoxy]phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 63056052) has the molecular formula C16H20BrNOS and a molecular weight of 354.31 g/mol. Its IUPAC name is N-[[3-[(4-bromothiophen-2-yl)methoxy]phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-[(4-bromothiophen-2-yl)methoxy]phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 63056052 |
| Molecular Formula | C16H20BrNOS |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[[3-[(4-bromothiophen-2-yl)methoxy]phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cccc(OCc2cc(Br)cs2)c1 |
| InChI | InChI=1S/C16H20BrNOS/c1-16(2,3)18-9-12-5-4-6-14(7-12)19-10-15-8-13(17)11-20-15/h4-8,11,18H,9-10H2,1-3H3 |
| InChIKey | IINTVXFJOJQLJC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |