C16H24N2O — CID 63057328
5-[2-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile (PubChem CID 63057328) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-[2-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile.
| Compound Name | 5-[2-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile |
|---|---|
| PubChem CID | 63057328 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 5-[2-[(2-methylpropylamino)methyl]phenoxy]pentanenitrile |
| SMILES | CC(C)CNCc1ccccc1OCCCCC#N |
| InChI | InChI=1S/C16H24N2O/c1-14(2)12-18-13-15-8-4-5-9-16(15)19-11-7-3-6-10-17/h4-5,8-9,14,18H,3,6-7,11-13H2,1-2H3 |
| InChIKey | JFYMCCGCBMQXCW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|