C16H24BrNO3 — CID 63057679
methyl 4-[4-bromo-2-[(tert-butylamino)methyl]phenoxy]butanoate (PubChem CID 63057679) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is methyl 4-[4-bromo-2-[(tert-butylamino)methyl]phenoxy]butanoate.
| Compound Name | methyl 4-[4-bromo-2-[(tert-butylamino)methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 63057679 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | methyl 4-[4-bromo-2-[(tert-butylamino)methyl]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(Br)cc1CNC(C)(C)C |
| InChI | InChI=1S/C16H24BrNO3/c1-16(2,3)18-11-12-10-13(17)7-8-14(12)21-9-5-6-15(19)20-4/h7-8,10,18H,5-6,9,11H2,1-4H3 |
| InChIKey | OCSJCAIDNILAKC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|