C13H18ClF3N2O — CID 63058645
3-chloro-2-[(2-methoxyethylamino)methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 63058645) has the molecular formula C13H18ClF3N2O and a molecular weight of 310.75 g/mol. Its IUPAC name is 3-chloro-2-[(2-methoxyethylamino)methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 3-chloro-2-[(2-methoxyethylamino)methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 63058645 |
| Molecular Formula | C13H18ClF3N2O |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-chloro-2-[(2-methoxyethylamino)methyl]-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | COCCNCc1c(Cl)cccc1N(C)CC(F)(F)F |
| InChI | InChI=1S/C13H18ClF3N2O/c1-19(9-13(15,16)17)12-5-3-4-11(14)10(12)8-18-6-7-20-2/h3-5,18H,6-9H2,1-2H3 |
| InChIKey | NXXPMNXTEIASMA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|