C12H21F3N4O — CID 63058817
4-[(2-methoxyethylamino)methyl]-N,1,3-trimethyl-N-(2,2,2-trifluoroethyl)pyrazol-5-amine (PubChem CID 63058817) has the molecular formula C12H21F3N4O and a molecular weight of 294.32 g/mol. Its IUPAC name is 4-[(2-methoxyethylamino)methyl]-N,1,3-trimethyl-N-(2,2,2-trifluoroethyl)pyrazol-5-amine.
| Compound Name | 4-[(2-methoxyethylamino)methyl]-N,1,3-trimethyl-N-(2,2,2-trifluoroethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 63058817 |
| Molecular Formula | C12H21F3N4O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4-[(2-methoxyethylamino)methyl]-N,1,3-trimethyl-N-(2,2,2-trifluoroethyl)pyrazol-5-amine |
| SMILES | COCCNCc1c(C)nn(C)c1N(C)CC(F)(F)F |
| InChI | InChI=1S/C12H21F3N4O/c1-9-10(7-16-5-6-20-4)11(19(3)17-9)18(2)8-12(13,14)15/h16H,5-8H2,1-4H3 |
| InChIKey | GYSNJIZKBJLVGC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|