C13H22N2 — CID 63058925
N,N-dimethyl-2-[(2-methylpropylamino)methyl]aniline (PubChem CID 63058925) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2-methylpropylamino)methyl]aniline.
| Compound Name | N,N-dimethyl-2-[(2-methylpropylamino)methyl]aniline |
|---|---|
| PubChem CID | 63058925 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N,N-dimethyl-2-[(2-methylpropylamino)methyl]aniline |
| SMILES | CC(C)CNCc1ccccc1N(C)C |
| InChI | InChI=1S/C13H22N2/c1-11(2)9-14-10-12-7-5-6-8-13(12)15(3)4/h5-8,11,14H,9-10H2,1-4H3 |
| InChIKey | UVEWBLNZZOWNNQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |