About 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline
4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline (PubChem CID 63060506) has the molecular formula C15H24F2N2
and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline.
Molecular Properties
| Compound Name | 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline |
| PubChem CID | 63060506 |
| Molecular Formula | C15H24F2N2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline |
| SMILES | CCN(CC)c1c(F)cc(CNC(C)(C)C)cc1F |
| InChI | InChI=1S/C15H24F2N2/c1-6-19(7-2)14-12(16)8-11(9-13(14)17)10-18-15(3,4)5/h8-9,18H,6-7,10H2,1-5H3 |
| InChIKey | KHSFCHWNCNAEHH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline?
The IUPAC name of 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline (CID 63060506) is 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline.
What is the SMILES notation for 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline?
The canonical SMILES for 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline is CCN(CC)c1c(F)cc(CNC(C)(C)C)cc1F.
What is the InChIKey of 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline?
The InChIKey is KHSFCHWNCNAEHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F2N2/c1-6-19(7-2)14-12(16)8-11(9-13(14)17)10-18-15(3,4)5/h8-9,18H,6-7,10H2,1-5H3.
What are the key properties of 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline?
4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline has a molecular weight of 270.37 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(tert-butylamino)methyl]-N,N-diethyl-2,6-difluoroaniline is sourced from PubChem (CID 63060506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).