C23H17NO7 — CID 630612
4-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenoxy]phthalic acid (PubChem CID 630612) has the molecular formula C23H17NO7 and a molecular weight of 419.39 g/mol. Its IUPAC name is 4-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenoxy]phthalic acid.
| Compound Name | 4-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenoxy]phthalic acid |
|---|---|
| PubChem CID | 630612 |
| Molecular Formula | C23H17NO7 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 4-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenoxy]phthalic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc(N3C(=O)C4C5C=CC(C5)C4C3=O)cc2)cc1C(=O)O |
| InChI | InChI=1S/C23H17NO7/c25-20-18-11-1-2-12(9-11)19(18)21(26)24(20)13-3-5-14(6-4-13)31-15-7-8-16(22(27)28)17(10-15)23(29)30/h1-8,10-12,18-19H,9H2,(H,27,28)(H,29,30) |
| InChIKey | YGQHLOJPSCUJAJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|