C21H17FN2O4 — CID 6306365
(5E)-5-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-1-(3-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 6306365) has the molecular formula C21H17FN2O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is (5E)-5-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-1-(3-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-1-(3-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6306365 |
| Molecular Formula | C21H17FN2O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (5E)-5-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-1-(3-hydroxypropyl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(CCCO)C(=O)/C1=C/c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C21H17FN2O4/c1-13-16(20(26)24(9-4-10-25)21(27)17(13)12-23)11-14-7-8-19(28-14)15-5-2-3-6-18(15)22/h2-3,5-8,11,25H,4,9-10H2,1H3/b16-11+ |
| InChIKey | HHCOXNSLRGBHMJ-LFIBNONCSA-N |
| XLogP | 3.06 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|