3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid

C11H18F3NO2 — CID 63066892

IUPAC3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid
SMILESCCN(C1CCCC1)C(CC(=O)O)C(F)(F)F
InChIInChI=1S/C11H18F3NO2/c1-2-15(8-5-3-4-6-8)9(7-10(16)17)11(12,13)14/h8-9H,2-7H2,1H3,(H,16,17)
InChIKeyHTGSFRVJHIOMMI-UHFFFAOYSA-N
MW253.26 g/mol
LogP2.66
Rot. Bonds5

About 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid

3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid (PubChem CID 63066892) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid.

Molecular Properties

Compound Name3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid
PubChem CID63066892
Molecular FormulaC11H18F3NO2
Molecular Weight253.26 g/mol
Exact Mass253.13
IUPAC Name3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid
SMILESCCN(C1CCCC1)C(CC(=O)O)C(F)(F)F
InChIInChI=1S/C11H18F3NO2/c1-2-15(8-5-3-4-6-8)9(7-10(16)17)11(12,13)14/h8-9H,2-7H2,1H3,(H,16,17)
InChIKeyHTGSFRVJHIOMMI-UHFFFAOYSA-N
XLogP2.66
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.26
LogP ≤ 52.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid?
The IUPAC name of 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid (CID 63066892) is 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid?
The canonical SMILES for 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid is CCN(C1CCCC1)C(CC(=O)O)C(F)(F)F.
What is the InChIKey of 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid?
The InChIKey is HTGSFRVJHIOMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO2/c1-2-15(8-5-3-4-6-8)9(7-10(16)17)11(12,13)14/h8-9H,2-7H2,1H3,(H,16,17).
What are the key properties of 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid?
3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid has a molecular weight of 253.26 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopentyl(ethyl)amino]-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 63066892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).