3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid

C15H20FNO2 — CID 63067272

IUPAC3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid
SMILESCC1CCCN(Cc2cc(C(=O)O)ccc2F)C1C
InChIInChI=1S/C15H20FNO2/c1-10-4-3-7-17(11(10)2)9-13-8-12(15(18)19)5-6-14(13)16/h5-6,8,10-11H,3-4,7,9H2,1-2H3,(H,18,19)
InChIKeyKQNFLNXQZOJROO-UHFFFAOYSA-N
MW265.33 g/mol
LogP3.14
Rot. Bonds3

About 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid

3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid (PubChem CID 63067272) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid.

Molecular Properties

Compound Name3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid
PubChem CID63067272
Molecular FormulaC15H20FNO2
Molecular Weight265.33 g/mol
Exact Mass265.15
IUPAC Name3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid
SMILESCC1CCCN(Cc2cc(C(=O)O)ccc2F)C1C
InChIInChI=1S/C15H20FNO2/c1-10-4-3-7-17(11(10)2)9-13-8-12(15(18)19)5-6-14(13)16/h5-6,8,10-11H,3-4,7,9H2,1-2H3,(H,18,19)
InChIKeyKQNFLNXQZOJROO-UHFFFAOYSA-N
XLogP3.14
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.33
LogP ≤ 53.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid?
The IUPAC name of 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid (CID 63067272) is 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid.
What is the SMILES notation for 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid?
The canonical SMILES for 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid is CC1CCCN(Cc2cc(C(=O)O)ccc2F)C1C.
What is the InChIKey of 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid?
The InChIKey is KQNFLNXQZOJROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO2/c1-10-4-3-7-17(11(10)2)9-13-8-12(15(18)19)5-6-14(13)16/h5-6,8,10-11H,3-4,7,9H2,1-2H3,(H,18,19).
What are the key properties of 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid?
3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid has a molecular weight of 265.33 g/mol, XLogP of 3.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3-dimethylpiperidin-1-yl)methyl]-4-fluorobenzoic acid is sourced from PubChem (CID 63067272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).