C17H26N2O2 — CID 63067293
3-[4-[(dimethylamino)methyl]piperidin-1-yl]-3-phenylpropanoic acid (PubChem CID 63067293) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-[4-[(dimethylamino)methyl]piperidin-1-yl]-3-phenylpropanoic acid.
| Compound Name | 3-[4-[(dimethylamino)methyl]piperidin-1-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 63067293 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-[4-[(dimethylamino)methyl]piperidin-1-yl]-3-phenylpropanoic acid |
| SMILES | CN(C)CC1CCN(C(CC(=O)O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H26N2O2/c1-18(2)13-14-8-10-19(11-9-14)16(12-17(20)21)15-6-4-3-5-7-15/h3-7,14,16H,8-13H2,1-2H3,(H,20,21) |
| InChIKey | SOJJQZQXIKPRJV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |