C16H31NO2 — CID 63067550
2-(dibutylamino)-4-methylcyclohexane-1-carboxylic acid (PubChem CID 63067550) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 2-(dibutylamino)-4-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-(dibutylamino)-4-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63067550 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 2-(dibutylamino)-4-methylcyclohexane-1-carboxylic acid |
| SMILES | CCCCN(CCCC)C1CC(C)CCC1C(=O)O |
| InChI | InChI=1S/C16H31NO2/c1-4-6-10-17(11-7-5-2)15-12-13(3)8-9-14(15)16(18)19/h13-15H,4-12H2,1-3H3,(H,18,19) |
| InChIKey | ZJKYPXJXJBJABI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |