C17H33NO3 — CID 63069195
2-[1-methoxypropan-2-yl(methyl)amino]-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid (PubChem CID 63069195) has the molecular formula C17H33NO3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 2-[1-methoxypropan-2-yl(methyl)amino]-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-[1-methoxypropan-2-yl(methyl)amino]-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63069195 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | 2-[1-methoxypropan-2-yl(methyl)amino]-4-(2-methylbutan-2-yl)cyclohexane-1-carboxylic acid |
| SMILES | CCC(C)(C)C1CCC(C(=O)O)C(N(C)C(C)COC)C1 |
| InChI | InChI=1S/C17H33NO3/c1-7-17(3,4)13-8-9-14(16(19)20)15(10-13)18(5)12(2)11-21-6/h12-15H,7-11H2,1-6H3,(H,19,20) |
| InChIKey | PYRRBSXRMNDODS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |