About N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine
N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine (PubChem CID 63070362) has the molecular formula C18H29FN2
and a molecular weight of 292.44 g/mol. Its IUPAC name is N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine |
| PubChem CID | 63070362 |
| Molecular Formula | C18H29FN2 |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC1(C)CCN(c2ccc(CNC(C)(C)C)cc2F)CC1 |
| InChI | InChI=1S/C18H29FN2/c1-17(2,3)20-13-14-6-7-16(15(19)12-14)21-10-8-18(4,5)9-11-21/h6-7,12,20H,8-11,13H2,1-5H3 |
| InChIKey | KOTPLXCQIUYNLU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine?
The IUPAC name of N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine (CID 63070362) is N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine is CC1(C)CCN(c2ccc(CNC(C)(C)C)cc2F)CC1.
What is the InChIKey of N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine?
The InChIKey is KOTPLXCQIUYNLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29FN2/c1-17(2,3)20-13-14-6-7-16(15(19)12-14)21-10-8-18(4,5)9-11-21/h6-7,12,20H,8-11,13H2,1-5H3.
What are the key properties of N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine?
N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine has a molecular weight of 292.44 g/mol, XLogP of 4.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(4,4-dimethylpiperidin-1-yl)-3-fluorophenyl]methyl]-2-methylpropan-2-amine is sourced from PubChem (CID 63070362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).