About 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine
3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine (PubChem CID 63071409) has the molecular formula C11H15F2NOS
and a molecular weight of 247.31 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine.
Molecular Properties
| Compound Name | 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine |
| PubChem CID | 63071409 |
| Molecular Formula | C11H15F2NOS |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine |
| SMILES | CCOC(CN)CSc1cc(F)ccc1F |
| InChI | InChI=1S/C11H15F2NOS/c1-2-15-9(6-14)7-16-11-5-8(12)3-4-10(11)13/h3-5,9H,2,6-7,14H2,1H3 |
| InChIKey | HVNRWRBEWVOJJW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine?
The IUPAC name of 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine (CID 63071409) is 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine.
What is the SMILES notation for 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine?
The canonical SMILES for 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine is CCOC(CN)CSc1cc(F)ccc1F.
What is the InChIKey of 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine?
The InChIKey is HVNRWRBEWVOJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NOS/c1-2-15-9(6-14)7-16-11-5-8(12)3-4-10(11)13/h3-5,9H,2,6-7,14H2,1H3.
What are the key properties of 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine?
3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine has a molecular weight of 247.31 g/mol, XLogP of 2.42, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-difluorophenyl)sulfanyl-2-ethoxypropan-1-amine is sourced from PubChem (CID 63071409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).