C13H23F3N4O — CID 63071495
N-ethyl-4-[(2-methoxyethylamino)methyl]-1,3-dimethyl-N-(2,2,2-trifluoroethyl)pyrazol-5-amine (PubChem CID 63071495) has the molecular formula C13H23F3N4O and a molecular weight of 308.35 g/mol. Its IUPAC name is N-ethyl-4-[(2-methoxyethylamino)methyl]-1,3-dimethyl-N-(2,2,2-trifluoroethyl)pyrazol-5-amine.
| Compound Name | N-ethyl-4-[(2-methoxyethylamino)methyl]-1,3-dimethyl-N-(2,2,2-trifluoroethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 63071495 |
| Molecular Formula | C13H23F3N4O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | N-ethyl-4-[(2-methoxyethylamino)methyl]-1,3-dimethyl-N-(2,2,2-trifluoroethyl)pyrazol-5-amine |
| SMILES | CCN(CC(F)(F)F)c1c(CNCCOC)c(C)nn1C |
| InChI | InChI=1S/C13H23F3N4O/c1-5-20(9-13(14,15)16)12-11(8-17-6-7-21-4)10(2)18-19(12)3/h17H,5-9H2,1-4H3 |
| InChIKey | JJZLCTTYKMXBHS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|