About 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid
3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid (PubChem CID 63072806) has the molecular formula C11H14F3NO2S
and a molecular weight of 281.30 g/mol. Its IUPAC name is 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid.
Molecular Properties
| Compound Name | 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid |
| PubChem CID | 63072806 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid |
| SMILES | CCN(Cc1cccs1)C(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO2S/c1-2-15(7-8-4-3-5-18-8)9(6-10(16)17)11(12,13)14/h3-5,9H,2,6-7H2,1H3,(H,16,17) |
| InChIKey | OGHMGIIQBBJOHI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid?
The IUPAC name of 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid (CID 63072806) is 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid?
The canonical SMILES for 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid is CCN(Cc1cccs1)C(CC(=O)O)C(F)(F)F.
What is the InChIKey of 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid?
The InChIKey is OGHMGIIQBBJOHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO2S/c1-2-15(7-8-4-3-5-18-8)9(6-10(16)17)11(12,13)14/h3-5,9H,2,6-7H2,1H3,(H,16,17).
What are the key properties of 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid?
3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid has a molecular weight of 281.30 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(thiophen-2-ylmethyl)amino]-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 63072806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).