About 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one
1-(4-methylphenyl)-4,6-diphenylpyridin-2-one (PubChem CID 630746) has the molecular formula C24H19NO
and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one |
| PubChem CID | 630746 |
| Molecular Formula | C24H19NO |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)cc(-c3ccccc3)cc2=O)cc1 |
| InChI | InChI=1S/C24H19NO/c1-18-12-14-22(15-13-18)25-23(20-10-6-3-7-11-20)16-21(17-24(25)26)19-8-4-2-5-9-19/h2-17H,1H3 |
| InChIKey | GGFSUMSWIRCAEO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one?
The IUPAC name of 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one (CID 630746) is 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one.
What is the SMILES notation for 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one?
The canonical SMILES for 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one is Cc1ccc(-n2c(-c3ccccc3)cc(-c3ccccc3)cc2=O)cc1.
What is the InChIKey of 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one?
The InChIKey is GGFSUMSWIRCAEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19NO/c1-18-12-14-22(15-13-18)25-23(20-10-6-3-7-11-20)16-21(17-24(25)26)19-8-4-2-5-9-19/h2-17H,1H3.
What are the key properties of 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one?
1-(4-methylphenyl)-4,6-diphenylpyridin-2-one has a molecular weight of 337.42 g/mol, XLogP of 5.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)-4,6-diphenylpyridin-2-one is sourced from PubChem (CID 630746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).