C26H37N3O2S — CID 6307484
1-[(4-butoxyphenyl)methyl]-3-[(Z)-(4-heptoxyphenyl)methylideneamino]thiourea (PubChem CID 6307484) has the molecular formula C26H37N3O2S and a molecular weight of 455.67 g/mol. Its IUPAC name is 1-[(4-butoxyphenyl)methyl]-3-[(Z)-(4-heptoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-[(4-butoxyphenyl)methyl]-3-[(Z)-(4-heptoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6307484 |
| Molecular Formula | C26H37N3O2S |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 1-[(4-butoxyphenyl)methyl]-3-[(Z)-(4-heptoxyphenyl)methylideneamino]thiourea |
| SMILES | CCCCCCCOc1ccc(/C=N\NC(=S)NCc2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C26H37N3O2S/c1-3-5-7-8-9-19-31-25-16-12-23(13-17-25)21-28-29-26(32)27-20-22-10-14-24(15-11-22)30-18-6-4-2/h10-17,21H,3-9,18-20H2,1-2H3,(H2,27,29,32)/b28-21- |
| InChIKey | QJPHNYFQAXOCCF-HFTWOUSFSA-N |
| XLogP | 6.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|