About 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid
3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid (PubChem CID 63075078) has the molecular formula C13H22F3NO2
and a molecular weight of 281.32 g/mol. Its IUPAC name is 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid.
Molecular Properties
| Compound Name | 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid |
| PubChem CID | 63075078 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid |
| SMILES | CCC1CCC(N(C)C(CC(=O)O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3NO2/c1-3-9-4-6-10(7-5-9)17(2)11(8-12(18)19)13(14,15)16/h9-11H,3-8H2,1-2H3,(H,18,19) |
| InChIKey | CNGLEQRXRMUOKF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid?
The IUPAC name of 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid (CID 63075078) is 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid?
The canonical SMILES for 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid is CCC1CCC(N(C)C(CC(=O)O)C(F)(F)F)CC1.
What is the InChIKey of 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid?
The InChIKey is CNGLEQRXRMUOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3NO2/c1-3-9-4-6-10(7-5-9)17(2)11(8-12(18)19)13(14,15)16/h9-11H,3-8H2,1-2H3,(H,18,19).
What are the key properties of 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid?
3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid has a molecular weight of 281.32 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-ethylcyclohexyl)-methylamino]-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 63075078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).