C15H20O3 — CID 63075152
3-cyclohexyloxy-2-phenylpropanoic acid (PubChem CID 63075152) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-cyclohexyloxy-2-phenylpropanoic acid.
| Compound Name | 3-cyclohexyloxy-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 63075152 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-cyclohexyloxy-2-phenylpropanoic acid |
| SMILES | O=C(O)C(COC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C15H20O3/c16-15(17)14(12-7-3-1-4-8-12)11-18-13-9-5-2-6-10-13/h1,3-4,7-8,13-14H,2,5-6,9-11H2,(H,16,17) |
| InChIKey | RTWUHYNMNYALLW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |