About 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid
4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid (PubChem CID 63075287) has the molecular formula C14H23F3N2O2
and a molecular weight of 308.34 g/mol. Its IUPAC name is 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid |
| PubChem CID | 63075287 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(C(=O)O)C(N2CCN(CC(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C14H23F3N2O2/c1-10-2-3-11(13(20)21)12(8-10)19-6-4-18(5-7-19)9-14(15,16)17/h10-12H,2-9H2,1H3,(H,20,21) |
| InChIKey | OEJZGUMJNZPDBO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid (CID 63075287) is 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid is CC1CCC(C(=O)O)C(N2CCN(CC(F)(F)F)CC2)C1.
What is the InChIKey of 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid?
The InChIKey is OEJZGUMJNZPDBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F3N2O2/c1-10-2-3-11(13(20)21)12(8-10)19-6-4-18(5-7-19)9-14(15,16)17/h10-12H,2-9H2,1H3,(H,20,21).
What are the key properties of 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid?
4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid has a molecular weight of 308.34 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 63075287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).