C14H10F2N4O — CID 63076359
[3,5-difluoro-4-(5-phenyltetrazol-2-yl)phenyl]methanol (PubChem CID 63076359) has the molecular formula C14H10F2N4O and a molecular weight of 288.26 g/mol. Its IUPAC name is [3,5-difluoro-4-(5-phenyltetrazol-2-yl)phenyl]methanol.
| Compound Name | [3,5-difluoro-4-(5-phenyltetrazol-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 63076359 |
| Molecular Formula | C14H10F2N4O |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | [3,5-difluoro-4-(5-phenyltetrazol-2-yl)phenyl]methanol |
| SMILES | OCc1cc(F)c(-n2nnc(-c3ccccc3)n2)c(F)c1 |
| InChI | InChI=1S/C14H10F2N4O/c15-11-6-9(8-21)7-12(16)13(11)20-18-14(17-19-20)10-4-2-1-3-5-10/h1-7,21H,8H2 |
| InChIKey | ZGZUYPNJFFUNFA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |