About 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene
5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene (PubChem CID 63076728) has the molecular formula C15H13ClF2O3
and a molecular weight of 314.72 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene.
Molecular Properties
| Compound Name | 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene |
| PubChem CID | 63076728 |
| Molecular Formula | C15H13ClF2O3 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene |
| SMILES | COc1cc(OC)cc(Oc2c(F)cc(CCl)cc2F)c1 |
| InChI | InChI=1S/C15H13ClF2O3/c1-19-10-5-11(20-2)7-12(6-10)21-15-13(17)3-9(8-16)4-14(15)18/h3-7H,8H2,1-2H3 |
| InChIKey | YQCZGDYUPIHAQP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene?
The IUPAC name of 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene (CID 63076728) is 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene.
What is the SMILES notation for 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene?
The canonical SMILES for 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene is COc1cc(OC)cc(Oc2c(F)cc(CCl)cc2F)c1.
What is the InChIKey of 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene?
The InChIKey is YQCZGDYUPIHAQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClF2O3/c1-19-10-5-11(20-2)7-12(6-10)21-15-13(17)3-9(8-16)4-14(15)18/h3-7H,8H2,1-2H3.
What are the key properties of 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene?
5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene has a molecular weight of 314.72 g/mol, XLogP of 4.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-2-(3,5-dimethoxyphenoxy)-1,3-difluorobenzene is sourced from PubChem (CID 63076728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).