About 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile
2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile (PubChem CID 63076822) has the molecular formula C8H4F3NO
and a molecular weight of 187.12 g/mol. Its IUPAC name is 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile.
Molecular Properties
| Compound Name | 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile |
| PubChem CID | 63076822 |
| Molecular Formula | C8H4F3NO |
| Molecular Weight | 187.12 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile |
| SMILES | N#CC(O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C8H4F3NO/c9-5-1-4(7(13)3-12)2-6(10)8(5)11/h1-2,7,13H |
| InChIKey | IYQZAVUOJTUOHY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.12 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile?
The IUPAC name of 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile (CID 63076822) is 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile.
What is the SMILES notation for 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile?
The canonical SMILES for 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile is N#CC(O)c1cc(F)c(F)c(F)c1.
What is the InChIKey of 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile?
The InChIKey is IYQZAVUOJTUOHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F3NO/c9-5-1-4(7(13)3-12)2-6(10)8(5)11/h1-2,7,13H.
What are the key properties of 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile?
2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile has a molecular weight of 187.12 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(3,4,5-trifluorophenyl)acetonitrile is sourced from PubChem (CID 63076822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).