About 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one
1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one (PubChem CID 63077166) has the molecular formula C12H15F2N3O
and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one |
| PubChem CID | 63077166 |
| Molecular Formula | C12H15F2N3O |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one |
| SMILES | NCc1cc(F)c(N2CCNC(=O)CC2)c(F)c1 |
| InChI | InChI=1S/C12H15F2N3O/c13-9-5-8(7-15)6-10(14)12(9)17-3-1-11(18)16-2-4-17/h5-6H,1-4,7,15H2,(H,16,18) |
| InChIKey | VJYZONSYIVIALY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one?
The IUPAC name of 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one (CID 63077166) is 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one.
What is the SMILES notation for 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one?
The canonical SMILES for 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one is NCc1cc(F)c(N2CCNC(=O)CC2)c(F)c1.
What is the InChIKey of 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one?
The InChIKey is VJYZONSYIVIALY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N3O/c13-9-5-8(7-15)6-10(14)12(9)17-3-1-11(18)16-2-4-17/h5-6H,1-4,7,15H2,(H,16,18).
What are the key properties of 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one?
1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one has a molecular weight of 255.27 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(aminomethyl)-2,6-difluorophenyl]-1,4-diazepan-5-one is sourced from PubChem (CID 63077166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).