C14H15F3N2S — CID 63077170
1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-methyl-1-(3,4,5-trifluorophenyl)methanamine (PubChem CID 63077170) has the molecular formula C14H15F3N2S and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-methyl-1-(3,4,5-trifluorophenyl)methanamine.
| Compound Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-methyl-1-(3,4,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 63077170 |
| Molecular Formula | C14H15F3N2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-methyl-1-(3,4,5-trifluorophenyl)methanamine |
| SMILES | CCc1nc(C(NC)c2cc(F)c(F)c(F)c2)sc1C |
| InChI | InChI=1S/C14H15F3N2S/c1-4-11-7(2)20-14(19-11)13(18-3)8-5-9(15)12(17)10(16)6-8/h5-6,13,18H,4H2,1-3H3 |
| InChIKey | MDRHQKVQYWYDIP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|