About 4-(4-methoxyphenyl)-2,6-diphenylpyridine
4-(4-methoxyphenyl)-2,6-diphenylpyridine (PubChem CID 630776) has the molecular formula C24H19NO
and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,6-diphenylpyridine.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-2,6-diphenylpyridine |
| PubChem CID | 630776 |
| Molecular Formula | C24H19NO |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,6-diphenylpyridine |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H19NO/c1-26-22-14-12-18(13-15-22)21-16-23(19-8-4-2-5-9-19)25-24(17-21)20-10-6-3-7-11-20/h2-17H,1H3 |
| InChIKey | UGBYHTZMSDBSCE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-methoxyphenyl)-2,6-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-2,6-diphenylpyridine?
The IUPAC name of 4-(4-methoxyphenyl)-2,6-diphenylpyridine (CID 630776) is 4-(4-methoxyphenyl)-2,6-diphenylpyridine.
What is the SMILES notation for 4-(4-methoxyphenyl)-2,6-diphenylpyridine?
The canonical SMILES for 4-(4-methoxyphenyl)-2,6-diphenylpyridine is COc1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-2,6-diphenylpyridine?
The InChIKey is UGBYHTZMSDBSCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19NO/c1-26-22-14-12-18(13-15-22)21-16-23(19-8-4-2-5-9-19)25-24(17-21)20-10-6-3-7-11-20/h2-17H,1H3.
What are the key properties of 4-(4-methoxyphenyl)-2,6-diphenylpyridine?
4-(4-methoxyphenyl)-2,6-diphenylpyridine has a molecular weight of 337.42 g/mol, XLogP of 6.09, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-2,6-diphenylpyridine is sourced from PubChem (CID 630776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).