About 1H-pyrazole-4-carbonyl azide
1H-pyrazole-4-carbonyl azide (PubChem CID 63079793) has the molecular formula C4H3N5O
and a molecular weight of 137.10 g/mol. Its IUPAC name is 1H-pyrazole-4-carbonyl azide.
Molecular Properties
| Compound Name | 1H-pyrazole-4-carbonyl azide |
| PubChem CID | 63079793 |
| Molecular Formula | C4H3N5O |
| Molecular Weight | 137.10 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 1H-pyrazole-4-carbonyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C4H3N5O/c5-9-8-4(10)3-1-6-7-2-3/h1-2H,(H,6,7) |
| InChIKey | KHLTWEVPOUQKBE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.10 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrazole-4-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole-4-carbonyl azide?
The IUPAC name of 1H-pyrazole-4-carbonyl azide (CID 63079793) is 1H-pyrazole-4-carbonyl azide.
What is the SMILES notation for 1H-pyrazole-4-carbonyl azide?
The canonical SMILES for 1H-pyrazole-4-carbonyl azide is [N-]=[N+]=NC(=O)c1cn[nH]c1.
What is the InChIKey of 1H-pyrazole-4-carbonyl azide?
The InChIKey is KHLTWEVPOUQKBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N5O/c5-9-8-4(10)3-1-6-7-2-3/h1-2H,(H,6,7).
What are the key properties of 1H-pyrazole-4-carbonyl azide?
1H-pyrazole-4-carbonyl azide has a molecular weight of 137.10 g/mol, XLogP of 0.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole-4-carbonyl azide is sourced from PubChem (CID 63079793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).