C16H21N3O — CID 63079908
1-[3-(1-phenylcyclopentyl)-1,2,4-oxadiazol-5-yl]propan-2-amine (PubChem CID 63079908) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-[3-(1-phenylcyclopentyl)-1,2,4-oxadiazol-5-yl]propan-2-amine.
| Compound Name | 1-[3-(1-phenylcyclopentyl)-1,2,4-oxadiazol-5-yl]propan-2-amine |
|---|---|
| PubChem CID | 63079908 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 1-[3-(1-phenylcyclopentyl)-1,2,4-oxadiazol-5-yl]propan-2-amine |
| SMILES | CC(N)Cc1nc(C2(c3ccccc3)CCCC2)no1 |
| InChI | InChI=1S/C16H21N3O/c1-12(17)11-14-18-15(19-20-14)16(9-5-6-10-16)13-7-3-2-4-8-13/h2-4,7-8,12H,5-6,9-11,17H2,1H3 |
| InChIKey | KZYDWRGVGPSLDT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |