C16H15N3OS — CID 63080018
5-[3-(1-phenylcyclobutyl)-1,2,4-oxadiazol-5-yl]thiophen-2-amine (PubChem CID 63080018) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-[3-(1-phenylcyclobutyl)-1,2,4-oxadiazol-5-yl]thiophen-2-amine.
| Compound Name | 5-[3-(1-phenylcyclobutyl)-1,2,4-oxadiazol-5-yl]thiophen-2-amine |
|---|---|
| PubChem CID | 63080018 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 5-[3-(1-phenylcyclobutyl)-1,2,4-oxadiazol-5-yl]thiophen-2-amine |
| SMILES | Nc1ccc(-c2nc(C3(c4ccccc4)CCC3)no2)s1 |
| InChI | InChI=1S/C16H15N3OS/c17-13-8-7-12(21-13)14-18-15(19-20-14)16(9-4-10-16)11-5-2-1-3-6-11/h1-3,5-8H,4,9-10,17H2 |
| InChIKey | XKCBSCGBNSQZJX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |