About 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine
5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 63080140) has the molecular formula C5H5N5S
and a molecular weight of 167.20 g/mol. Its IUPAC name is 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine |
| PubChem CID | 63080140 |
| Molecular Formula | C5H5N5S |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccn[nH]2)s1 |
| InChI | InChI=1S/C5H5N5S/c6-5-10-9-4(11-5)3-1-2-7-8-3/h1-2H,(H2,6,10)(H,7,8) |
| InChIKey | PKGVKGYNVCCZFL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine (CID 63080140) is 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine is Nc1nnc(-c2ccn[nH]2)s1.
What is the InChIKey of 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine?
The InChIKey is PKGVKGYNVCCZFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5S/c6-5-10-9-4(11-5)3-1-2-7-8-3/h1-2H,(H2,6,10)(H,7,8).
What are the key properties of 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine?
5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine has a molecular weight of 167.20 g/mol, XLogP of 0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-pyrazol-5-yl)-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 63080140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).