C28H23IN2O4S — CID 6308120
(4E)-4-[hydroxy-(3-propoxyphenyl)methylidene]-5-(4-iodophenyl)-1-(6-methyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 6308120) has the molecular formula C28H23IN2O4S and a molecular weight of 610.47 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(3-propoxyphenyl)methylidene]-5-(4-iodophenyl)-1-(6-methyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(3-propoxyphenyl)methylidene]-5-(4-iodophenyl)-1-(6-methyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6308120 |
| Molecular Formula | C28H23IN2O4S |
| Molecular Weight | 610.47 g/mol |
| Exact Mass | 610.04 |
| IUPAC Name | (4E)-4-[hydroxy-(3-propoxyphenyl)methylidene]-5-(4-iodophenyl)-1-(6-methyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C)cc4s3)C2c2ccc(I)cc2)c1 |
| InChI | InChI=1S/C28H23IN2O4S/c1-3-13-35-20-6-4-5-18(15-20)25(32)23-24(17-8-10-19(29)11-9-17)31(27(34)26(23)33)28-30-21-12-7-16(2)14-22(21)36-28/h4-12,14-15,24,32H,3,13H2,1-2H3/b25-23+ |
| InChIKey | LSJGNBWHWGQIER-WJTDDFOZSA-N |
| XLogP | 6.62 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.47 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|