About 2,5-bis(1-adamantyl)-1,3,4-oxadiazole
2,5-bis(1-adamantyl)-1,3,4-oxadiazole (PubChem CID 630821) has the molecular formula C22H30N2O
and a molecular weight of 338.50 g/mol. Its IUPAC name is 2,5-bis(1-adamantyl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2,5-bis(1-adamantyl)-1,3,4-oxadiazole |
| PubChem CID | 630821 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 2,5-bis(1-adamantyl)-1,3,4-oxadiazole |
| SMILES | C1C2CC3CC1CC(c1nnc(C45CC6CC(CC(C6)C4)C5)o1)(C2)C3 |
| InChI | InChI=1S/C22H30N2O/c1-13-2-15-3-14(1)8-21(7-13,9-15)19-23-24-20(25-19)22-10-16-4-17(11-22)6-18(5-16)12-22/h13-18H,1-12H2 |
| InChIKey | HWGAFZNFSGNHQU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-bis(1-adamantyl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(1-adamantyl)-1,3,4-oxadiazole?
The IUPAC name of 2,5-bis(1-adamantyl)-1,3,4-oxadiazole (CID 630821) is 2,5-bis(1-adamantyl)-1,3,4-oxadiazole.
What is the SMILES notation for 2,5-bis(1-adamantyl)-1,3,4-oxadiazole?
The canonical SMILES for 2,5-bis(1-adamantyl)-1,3,4-oxadiazole is C1C2CC3CC1CC(c1nnc(C45CC6CC(CC(C6)C4)C5)o1)(C2)C3.
What is the InChIKey of 2,5-bis(1-adamantyl)-1,3,4-oxadiazole?
The InChIKey is HWGAFZNFSGNHQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O/c1-13-2-15-3-14(1)8-21(7-13,9-15)19-23-24-20(25-19)22-10-16-4-17(11-22)6-18(5-16)12-22/h13-18H,1-12H2.
What are the key properties of 2,5-bis(1-adamantyl)-1,3,4-oxadiazole?
2,5-bis(1-adamantyl)-1,3,4-oxadiazole has a molecular weight of 338.50 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(1-adamantyl)-1,3,4-oxadiazole is sourced from PubChem (CID 630821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).