C11H14F3NO — CID 63083089
3-amino-2-(3,5-dimethylphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 63083089) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-amino-2-(3,5-dimethylphenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-amino-2-(3,5-dimethylphenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 63083089 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-amino-2-(3,5-dimethylphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1cc(C)cc(C(O)(CN)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO/c1-7-3-8(2)5-9(4-7)10(16,6-15)11(12,13)14/h3-5,16H,6,15H2,1-2H3 |
| InChIKey | KIYGSHKSRHEXLS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |