C10H2Cl3F5N2 — CID 63086208
4,6,8-trichloro-2-(1,1,2,2,2-pentafluoroethyl)quinazoline (PubChem CID 63086208) has the molecular formula C10H2Cl3F5N2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 4,6,8-trichloro-2-(1,1,2,2,2-pentafluoroethyl)quinazoline.
| Compound Name | 4,6,8-trichloro-2-(1,1,2,2,2-pentafluoroethyl)quinazoline |
|---|---|
| PubChem CID | 63086208 |
| Molecular Formula | C10H2Cl3F5N2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 349.92 |
| IUPAC Name | 4,6,8-trichloro-2-(1,1,2,2,2-pentafluoroethyl)quinazoline |
| SMILES | FC(F)(F)C(F)(F)c1nc(Cl)c2cc(Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C10H2Cl3F5N2/c11-3-1-4-6(5(12)2-3)19-8(20-7(4)13)9(14,15)10(16,17)18/h1-2H |
| InChIKey | AFDXJYHYDSODIG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|