C14H15ClFN3 — CID 63087158
N-[(3-chloro-4-fluorophenyl)-pyrimidin-5-ylmethyl]propan-1-amine (PubChem CID 63087158) has the molecular formula C14H15ClFN3 and a molecular weight of 279.75 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)-pyrimidin-5-ylmethyl]propan-1-amine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)-pyrimidin-5-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 63087158 |
| Molecular Formula | C14H15ClFN3 |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)-pyrimidin-5-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1cncnc1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H15ClFN3/c1-2-5-19-14(11-7-17-9-18-8-11)10-3-4-13(16)12(15)6-10/h3-4,6-9,14,19H,2,5H2,1H3 |
| InChIKey | CJNQNHOYXIYPEB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |