C14H21ClN4 — CID 63087384
3-chloro-4-[methyl-(1-methylpiperidin-4-yl)amino]benzenecarboximidamide (PubChem CID 63087384) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is 3-chloro-4-[methyl-(1-methylpiperidin-4-yl)amino]benzenecarboximidamide.
| Compound Name | 3-chloro-4-[methyl-(1-methylpiperidin-4-yl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 63087384 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3-chloro-4-[methyl-(1-methylpiperidin-4-yl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)C2CCN(C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H21ClN4/c1-18-7-5-11(6-8-18)19(2)13-4-3-10(14(16)17)9-12(13)15/h3-4,9,11H,5-8H2,1-2H3,(H3,16,17) |
| InChIKey | OQWGGYJRWUMPQR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|