C13H18ClN3S — CID 63088945
3-chloro-4-[(1-methylpyrrolidin-3-yl)methylamino]benzenecarbothioamide (PubChem CID 63088945) has the molecular formula C13H18ClN3S and a molecular weight of 283.83 g/mol. Its IUPAC name is 3-chloro-4-[(1-methylpyrrolidin-3-yl)methylamino]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[(1-methylpyrrolidin-3-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 63088945 |
| Molecular Formula | C13H18ClN3S |
| Molecular Weight | 283.83 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3-chloro-4-[(1-methylpyrrolidin-3-yl)methylamino]benzenecarbothioamide |
| SMILES | CN1CCC(CNc2ccc(C(N)=S)cc2Cl)C1 |
| InChI | InChI=1S/C13H18ClN3S/c1-17-5-4-9(8-17)7-16-12-3-2-10(13(15)18)6-11(12)14/h2-3,6,9,16H,4-5,7-8H2,1H3,(H2,15,18) |
| InChIKey | PMCHVYSYXNBHHB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.83 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|