About 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine
5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine (PubChem CID 63090384) has the molecular formula C7H5Cl2N3S
and a molecular weight of 234.11 g/mol. Its IUPAC name is 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine.
Molecular Properties
| Compound Name | 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine |
| PubChem CID | 63090384 |
| Molecular Formula | C7H5Cl2N3S |
| Molecular Weight | 234.11 g/mol |
| Exact Mass | 232.96 |
| IUPAC Name | 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine |
| SMILES | CNc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C7H5Cl2N3S/c1-10-5-3(8)2-4(9)6-7(5)12-13-11-6/h2,10H,1H3 |
| InChIKey | HSGRUDYYYVWFPG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.11 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine?
The IUPAC name of 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine (CID 63090384) is 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine.
What is the SMILES notation for 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine?
The canonical SMILES for 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine is CNc1c(Cl)cc(Cl)c2nsnc12.
What is the InChIKey of 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine?
The InChIKey is HSGRUDYYYVWFPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2N3S/c1-10-5-3(8)2-4(9)6-7(5)12-13-11-6/h2,10H,1H3.
What are the key properties of 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine?
5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine has a molecular weight of 234.11 g/mol, XLogP of 3.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-N-methyl-2,1,3-benzothiadiazol-4-amine is sourced from PubChem (CID 63090384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).