About N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide
N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide (PubChem CID 63090701) has the molecular formula C9H17F3N2O2S
and a molecular weight of 274.31 g/mol. Its IUPAC name is N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide.
Molecular Properties
| Compound Name | N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide |
| PubChem CID | 63090701 |
| Molecular Formula | C9H17F3N2O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C9H17F3N2O2S/c1-2-17(15,16)13-5-8-3-4-14(6-8)7-9(10,11)12/h8,13H,2-7H2,1H3 |
| InChIKey | UBBPHAXIESTYIZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide?
The IUPAC name of N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide (CID 63090701) is N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide.
What is the SMILES notation for N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide?
The canonical SMILES for N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide is CCS(=O)(=O)NCC1CCN(CC(F)(F)F)C1.
What is the InChIKey of N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide?
The InChIKey is UBBPHAXIESTYIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O2S/c1-2-17(15,16)13-5-8-3-4-14(6-8)7-9(10,11)12/h8,13H,2-7H2,1H3.
What are the key properties of N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide?
N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide has a molecular weight of 274.31 g/mol, XLogP of 0.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]ethanesulfonamide is sourced from PubChem (CID 63090701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).