About 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one
5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one (PubChem CID 63091025) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one |
| PubChem CID | 63091025 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(COc2cccc3c2CCC3O)O1 |
| InChI | InChI=1S/C13H15NO4/c15-11-5-4-10-9(11)2-1-3-12(10)17-7-8-6-14-13(16)18-8/h1-3,8,11,15H,4-7H2,(H,14,16) |
| InChIKey | MIRHBHPWFTYRFO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one?
The IUPAC name of 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one (CID 63091025) is 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one is O=C1NCC(COc2cccc3c2CCC3O)O1.
What is the InChIKey of 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one?
The InChIKey is MIRHBHPWFTYRFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c15-11-5-4-10-9(11)2-1-3-12(10)17-7-8-6-14-13(16)18-8/h1-3,8,11,15H,4-7H2,(H,14,16).
What are the key properties of 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one?
5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one has a molecular weight of 249.27 g/mol, XLogP of 1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxymethyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 63091025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).