About 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide
2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide (PubChem CID 63091291) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide |
| PubChem CID | 63091291 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CC(O)C1 |
| InChI | InChI=1S/C7H14N2O2/c1-8(2)7(11)5-9-3-6(10)4-9/h6,10H,3-5H2,1-2H3 |
| InChIKey | XKUOIJLYWBONKI-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide (CID 63091291) is 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide is CN(C)C(=O)CN1CC(O)C1.
What is the InChIKey of 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide?
The InChIKey is XKUOIJLYWBONKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-8(2)7(11)5-9-3-6(10)4-9/h6,10H,3-5H2,1-2H3.
What are the key properties of 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide?
2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide has a molecular weight of 158.20 g/mol, XLogP of -1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxyazetidin-1-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 63091291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).