C9H12ClN3O — CID 63092115
4-(2-aminoethylamino)-3-chlorobenzamide (PubChem CID 63092115) has the molecular formula C9H12ClN3O and a molecular weight of 213.67 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-3-chlorobenzamide.
| Compound Name | 4-(2-aminoethylamino)-3-chlorobenzamide |
|---|---|
| PubChem CID | 63092115 |
| Molecular Formula | C9H12ClN3O |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 4-(2-aminoethylamino)-3-chlorobenzamide |
| SMILES | NCCNc1ccc(C(N)=O)cc1Cl |
| InChI | InChI=1S/C9H12ClN3O/c10-7-5-6(9(12)14)1-2-8(7)13-4-3-11/h1-2,5,13H,3-4,11H2,(H2,12,14) |
| InChIKey | VDYIWGPCOFWHBQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |