C15H13ClN2O3 — CID 63094208
2-(1,3-benzodioxol-5-ylmethoxy)-4-chlorobenzenecarboximidamide (PubChem CID 63094208) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethoxy)-4-chlorobenzenecarboximidamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethoxy)-4-chlorobenzenecarboximidamide |
|---|---|
| PubChem CID | 63094208 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethoxy)-4-chlorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cl)cc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13ClN2O3/c16-10-2-3-11(15(17)18)13(6-10)19-7-9-1-4-12-14(5-9)21-8-20-12/h1-6H,7-8H2,(H3,17,18) |
| InChIKey | PLYKXGLIYUKOBQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|