C12H17NO2 — CID 63095165
N-methyl-6-propoxy-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 63095165) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-methyl-6-propoxy-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | N-methyl-6-propoxy-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 63095165 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-methyl-6-propoxy-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCCOc1ccc2c(c1)OCC2NC |
| InChI | InChI=1S/C12H17NO2/c1-3-6-14-9-4-5-10-11(13-2)8-15-12(10)7-9/h4-5,7,11,13H,3,6,8H2,1-2H3 |
| InChIKey | MEZMDDDWFJXHCR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |